C13H15N5OS — CID 105328732
[2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-methoxy-3-pyridinyl)ethyl]hydrazine (PubChem CID 105328732) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-methoxy-3-pyridinyl)ethyl]hydrazine.
| Compound Name | [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-methoxy-3-pyridinyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105328732 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | [2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(2-methoxy-3-pyridinyl)ethyl]hydrazine |
| SMILES | COc1ncccc1C(Cc1cn2ccsc2n1)NN |
| InChI | InChI=1S/C13H15N5OS/c1-19-12-10(3-2-4-15-12)11(17-14)7-9-8-18-5-6-20-13(18)16-9/h2-6,8,11,17H,7,14H2,1H3 |
| InChIKey | DJNVFJLLWDMXAQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 77.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|