C12H11N3OS — CID 115332807
2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyridin-2-ylethanol (PubChem CID 115332807) has the molecular formula C12H11N3OS and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyridin-2-ylethanol.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyridin-2-ylethanol |
|---|---|
| PubChem CID | 115332807 |
| Molecular Formula | C12H11N3OS |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-pyridin-2-ylethanol |
| SMILES | OC(Cc1cn2ccsc2n1)c1ccccn1 |
| InChI | InChI=1S/C12H11N3OS/c16-11(10-3-1-2-4-13-10)7-9-8-15-5-6-17-12(15)14-9/h1-6,8,11,16H,7H2 |
| InChIKey | DYAMVAQCBDOQAN-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |