C11H9IN2OS2 — CID 115828284
2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(5-iodothiophen-3-yl)ethanol (PubChem CID 115828284) has the molecular formula C11H9IN2OS2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(5-iodothiophen-3-yl)ethanol.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(5-iodothiophen-3-yl)ethanol |
|---|---|
| PubChem CID | 115828284 |
| Molecular Formula | C11H9IN2OS2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-(5-iodothiophen-3-yl)ethanol |
| SMILES | OC(Cc1cn2ccsc2n1)c1csc(I)c1 |
| InChI | InChI=1S/C11H9IN2OS2/c12-10-3-7(6-17-10)9(15)4-8-5-14-1-2-16-11(14)13-8/h1-3,5-6,9,15H,4H2 |
| InChIKey | FZZPDMRSHKZMKB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|