C13H13N3OS — CID 113289157
1-(2-aminophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol (PubChem CID 113289157) has the molecular formula C13H13N3OS and a molecular weight of 259.33 g/mol. Its IUPAC name is 1-(2-aminophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol.
| Compound Name | 1-(2-aminophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
|---|---|
| PubChem CID | 113289157 |
| Molecular Formula | C13H13N3OS |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-(2-aminophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
| SMILES | Nc1ccccc1C(O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H13N3OS/c14-11-4-2-1-3-10(11)12(17)7-9-8-16-5-6-18-13(16)15-9/h1-6,8,12,17H,7,14H2 |
| InChIKey | WMJWENRCPPSGDL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|