C13H12BrN3OS — CID 82704079
1-(2-amino-5-bromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol (PubChem CID 82704079) has the molecular formula C13H12BrN3OS and a molecular weight of 338.23 g/mol. Its IUPAC name is 1-(2-amino-5-bromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol.
| Compound Name | 1-(2-amino-5-bromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
|---|---|
| PubChem CID | 82704079 |
| Molecular Formula | C13H12BrN3OS |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 336.99 |
| IUPAC Name | 1-(2-amino-5-bromophenyl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
| SMILES | Nc1ccc(Br)cc1C(O)Cc1cn2ccsc2n1 |
| InChI | InChI=1S/C13H12BrN3OS/c14-8-1-2-11(15)10(5-8)12(18)6-9-7-17-3-4-19-13(17)16-9/h1-5,7,12,18H,6,15H2 |
| InChIKey | BFCBDVBLFDBQCK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|