C11H10N2O2S — CID 115332847
1-(furan-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol (PubChem CID 115332847) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-(furan-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol.
| Compound Name | 1-(furan-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
|---|---|
| PubChem CID | 115332847 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(furan-3-yl)-2-imidazo[2,1-b][1,3]thiazol-6-ylethanol |
| SMILES | OC(Cc1cn2ccsc2n1)c1ccoc1 |
| InChI | InChI=1S/C11H10N2O2S/c14-10(8-1-3-15-7-8)5-9-6-13-2-4-16-11(13)12-9/h1-4,6-7,10,14H,5H2 |
| InChIKey | QVHPLTVPLNZMLV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 50.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |