C12H12N2O — CID 11458306
1,2-dipyridin-2-ylethanol (PubChem CID 11458306) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 1,2-dipyridin-2-ylethanol.
| Compound Name | 1,2-dipyridin-2-ylethanol |
|---|---|
| PubChem CID | 11458306 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 1,2-dipyridin-2-ylethanol |
| SMILES | OC(Cc1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C12H12N2O/c15-12(11-6-2-4-8-14-11)9-10-5-1-3-7-13-10/h1-8,12,15H,9H2 |
| InChIKey | LTYQJTOIWICODT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |