2-hydroxy-3-pyridin-2-ylpropanoic acid chloride

C8H9ClNO3- — CID 5351816

IUPAC2-hydroxy-3-pyridin-2-ylpropanoic acid chloride
SMILESO=C(O)C(O)Cc1ccccn1.[Cl-]
InChIInChI=1S/C8H9NO3.ClH/c10-7(8(11)12)5-6-3-1-2-4-9-6;/h1-4,7,10H,5H2,(H,11,12);1H/p-1
InChIKeyBUKSODWJMZMMJQ-UHFFFAOYSA-M
MW202.62 g/mol
LogP-2.93
Rot. Bonds3

About 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride

2-hydroxy-3-pyridin-2-ylpropanoic acid chloride (PubChem CID 5351816) has the molecular formula C8H9ClNO3- and a molecular weight of 202.62 g/mol. Its IUPAC name is 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride.

Molecular Properties

Compound Name2-hydroxy-3-pyridin-2-ylpropanoic acid chloride
PubChem CID5351816
Molecular FormulaC8H9ClNO3-
Molecular Weight202.62 g/mol
Exact Mass202.03
IUPAC Name2-hydroxy-3-pyridin-2-ylpropanoic acid chloride
SMILESO=C(O)C(O)Cc1ccccn1.[Cl-]
InChIInChI=1S/C8H9NO3.ClH/c10-7(8(11)12)5-6-3-1-2-4-9-6;/h1-4,7,10H,5H2,(H,11,12);1H/p-1
InChIKeyBUKSODWJMZMMJQ-UHFFFAOYSA-M
XLogP-2.93
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.62
LogP ≤ 5-2.93
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-amino-3-pyridin-2-ylpropanoic acid;hydrochloride
CID 46705394
(2S)-2-nitroso-3-pyridin-2-ylpropanoic acid
CID 88932015
2-hydroxy-7-pyridin-2-ylheptanoic acid
CID 175122940
2,3-dihydroxybutanedioic acid;pyridin-2-ylmethanol
CID 70556575
(2S)-2-(carboxyamino)-3-pyridin-2-ylpropanoic acid
CID 90150229
2-(ethylamino)-3-pyridin-2-ylpropanoic acid
CID 83698578
2-hydroxy-1-(4-methoxyphenyl)-3-pyridin-2-ylpropan-1-one
CID 132915461
4-pyridin-2-yl-2-(2-pyridin-2-ylethyl)butanoic acid
CID 54563679
fermium;2-(oxomethylamino)-3-pyridin-2-ylpropanoic acid
CID 171093339
2-(propanoylamino)-3-pyridin-2-ylpropanoic acid
CID 141086627
1,2-dipyridin-2-ylethanol
CID 11458306
2-[(2-methylphenyl)methyl]-3-pyridin-2-ylpropanoic acid
CID 79418895

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride?
The IUPAC name of 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride (CID 5351816) is 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride.
What is the SMILES notation for 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride?
The canonical SMILES for 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride is O=C(O)C(O)Cc1ccccn1.[Cl-].
What is the InChIKey of 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride?
The InChIKey is BUKSODWJMZMMJQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H9NO3.ClH/c10-7(8(11)12)5-6-3-1-2-4-9-6;/h1-4,7,10H,5H2,(H,11,12);1H/p-1.
What are the key properties of 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride?
2-hydroxy-3-pyridin-2-ylpropanoic acid chloride has a molecular weight of 202.62 g/mol, XLogP of -2.93, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-pyridin-2-ylpropanoic acid chloride is sourced from PubChem (CID 5351816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).