C10H13NO7 — CID 70556575
2,3-dihydroxybutanedioic acid;pyridin-2-ylmethanol (PubChem CID 70556575) has the molecular formula C10H13NO7 and a molecular weight of 259.21 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;pyridin-2-ylmethanol.
| Compound Name | 2,3-dihydroxybutanedioic acid;pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 70556575 |
| Molecular Formula | C10H13NO7 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;pyridin-2-ylmethanol |
| SMILES | O=C(O)C(O)C(O)C(=O)O.OCc1ccccn1 |
| InChI | InChI=1S/C6H7NO.C4H6O6/c8-5-6-3-1-2-4-7-6;5-1(3(7)8)2(6)4(9)10/h1-4,8H,5H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | VNKYOUJKVDKEIK-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |