About CID 131857449
CID 131857449 (PubChem CID 131857449) has the molecular formula C7H7NNaO2
and a molecular weight of 160.13 g/mol.
Molecular Properties
| Compound Name | CID 131857449 |
| PubChem CID | 131857449 |
| Molecular Formula | C7H7NNaO2 |
| Molecular Weight | 160.13 g/mol |
| Exact Mass | 160.04 |
| IUPAC Name | — |
| SMILES | O=C(O)Cc1ccccn1.[Na] |
| InChI | InChI=1S/C7H7NO2.Na/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10); |
| InChIKey | QHGLCUAVIOBFOX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.13 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 131857449 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131857449?
The IUPAC name of CID 131857449 (CID 131857449) is not available.
What is the SMILES notation for CID 131857449?
The canonical SMILES for CID 131857449 is O=C(O)Cc1ccccn1.[Na].
What is the InChIKey of CID 131857449?
The InChIKey is QHGLCUAVIOBFOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.Na/c9-7(10)5-6-3-1-2-4-8-6;/h1-4H,5H2,(H,9,10);.
What are the key properties of CID 131857449?
CID 131857449 has a molecular weight of 160.13 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131857449 is sourced from PubChem (CID 131857449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).