About ethyl acetate;2-pyridin-2-ylacetic acid
ethyl acetate;2-pyridin-2-ylacetic acid (PubChem CID 70044808) has the molecular formula C11H15NO4
and a molecular weight of 225.24 g/mol. Its IUPAC name is ethyl acetate;2-pyridin-2-ylacetic acid.
Molecular Properties
| Compound Name | ethyl acetate;2-pyridin-2-ylacetic acid |
| PubChem CID | 70044808 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | ethyl acetate;2-pyridin-2-ylacetic acid |
| SMILES | CCOC(C)=O.O=C(O)Cc1ccccn1 |
| InChI | InChI=1S/C7H7NO2.C4H8O2/c9-7(10)5-6-3-1-2-4-8-6;1-3-6-4(2)5/h1-4H,5H2,(H,9,10);3H2,1-2H3 |
| InChIKey | LYEWJUQTCPOXLM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl acetate;2-pyridin-2-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;2-pyridin-2-ylacetic acid?
The IUPAC name of ethyl acetate;2-pyridin-2-ylacetic acid (CID 70044808) is ethyl acetate;2-pyridin-2-ylacetic acid.
What is the SMILES notation for ethyl acetate;2-pyridin-2-ylacetic acid?
The canonical SMILES for ethyl acetate;2-pyridin-2-ylacetic acid is CCOC(C)=O.O=C(O)Cc1ccccn1.
What is the InChIKey of ethyl acetate;2-pyridin-2-ylacetic acid?
The InChIKey is LYEWJUQTCPOXLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C4H8O2/c9-7(10)5-6-3-1-2-4-8-6;1-3-6-4(2)5/h1-4H,5H2,(H,9,10);3H2,1-2H3.
What are the key properties of ethyl acetate;2-pyridin-2-ylacetic acid?
ethyl acetate;2-pyridin-2-ylacetic acid has a molecular weight of 225.24 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;2-pyridin-2-ylacetic acid is sourced from PubChem (CID 70044808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).