C11H14N2O3 — CID 55026375
ethyl 2-[(2-pyridin-2-ylacetyl)amino]acetate (PubChem CID 55026375) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl 2-[(2-pyridin-2-ylacetyl)amino]acetate.
| Compound Name | ethyl 2-[(2-pyridin-2-ylacetyl)amino]acetate |
|---|---|
| PubChem CID | 55026375 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | ethyl 2-[(2-pyridin-2-ylacetyl)amino]acetate |
| SMILES | CCOC(=O)CNC(=O)Cc1ccccn1 |
| InChI | InChI=1S/C11H14N2O3/c1-2-16-11(15)8-13-10(14)7-9-5-3-4-6-12-9/h3-6H,2,7-8H2,1H3,(H,13,14) |
| InChIKey | AUNVSARZBUPOIN-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |