2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid

C12H12N2O2S — CID 82131126

IUPAC2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(CCc2ccccn2)n1
InChIInChI=1S/C12H12N2O2S/c15-12(16)7-10-8-17-11(14-10)5-4-9-3-1-2-6-13-9/h1-3,6,8H,4-5,7H2,(H,15,16)
InChIKeyVTGHOAPLGNCKSD-UHFFFAOYSA-N
MW248.31 g/mol
LogP1.95
Rot. Bonds5

About 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid

2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 82131126) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid
PubChem CID82131126
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(CCc2ccccn2)n1
InChIInChI=1S/C12H12N2O2S/c15-12(16)7-10-8-17-11(14-10)5-4-9-3-1-2-6-13-9/h1-3,6,8H,4-5,7H2,(H,15,16)
InChIKeyVTGHOAPLGNCKSD-UHFFFAOYSA-N
XLogP1.95
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid (CID 82131126) is 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(CCc2ccccn2)n1.
What is the InChIKey of 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is VTGHOAPLGNCKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c15-12(16)7-10-8-17-11(14-10)5-4-9-3-1-2-6-13-9/h1-3,6,8H,4-5,7H2,(H,15,16).
What are the key properties of 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 248.31 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-pyridin-2-ylethyl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 82131126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).