C19H17NO3S — CID 4980882
2-[2-[2-(4-phenylphenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 4980882) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-[2-[2-(4-phenylphenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(4-phenylphenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 4980882 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[2-[2-(4-phenylphenoxy)ethyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(CCOc2ccc(-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C19H17NO3S/c21-19(22)12-16-13-24-18(20-16)10-11-23-17-8-6-15(7-9-17)14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H,21,22) |
| InChIKey | CPFRPXKTDRMOMK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |