C20H19NO5S — CID 20987846
2-[2-[3-[2-(4-methoxyphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20987846) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-[2-[3-[2-(4-methoxyphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[3-[2-(4-methoxyphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20987846 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 2-[2-[3-[2-(4-methoxyphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(OCCOc2cccc(-c3nc(CC(=O)O)cs3)c2)cc1 |
| InChI | InChI=1S/C20H19NO5S/c1-24-16-5-7-17(8-6-16)25-9-10-26-18-4-2-3-14(11-18)20-21-15(13-27-20)12-19(22)23/h2-8,11,13H,9-10,12H2,1H3,(H,22,23) |
| InChIKey | LOWSATZJDXAQPB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|