C18H15NO4S — CID 20991322
2-[2-[4-(3-methoxyphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20991322) has the molecular formula C18H15NO4S and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-[2-[4-(3-methoxyphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-(3-methoxyphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20991322 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[2-[4-(3-methoxyphenoxy)phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1cccc(Oc2ccc(-c3nc(CC(=O)O)cs3)cc2)c1 |
| InChI | InChI=1S/C18H15NO4S/c1-22-15-3-2-4-16(10-15)23-14-7-5-12(6-8-14)18-19-13(11-24-18)9-17(20)21/h2-8,10-11H,9H2,1H3,(H,20,21) |
| InChIKey | PCHIDIYRPIZGTG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |