C21H21NO5S — CID 20990950
2-[2-[4-methoxy-3-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20990950) has the molecular formula C21H21NO5S and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-[2-[4-methoxy-3-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-methoxy-3-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20990950 |
| Molecular Formula | C21H21NO5S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | 2-[2-[4-methoxy-3-[2-(4-methylphenoxy)ethoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(-c2nc(CC(=O)O)cs2)cc1OCCOc1ccc(C)cc1 |
| InChI | InChI=1S/C21H21NO5S/c1-14-3-6-17(7-4-14)26-9-10-27-19-11-15(5-8-18(19)25-2)21-22-16(13-28-21)12-20(23)24/h3-8,11,13H,9-10,12H2,1-2H3,(H,23,24) |
| InChIKey | AGSIDGMMZYSSKL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|