C24H28N2O4S — CID 55799785
2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(4-methylphenoxy)butyl]acetamide (PubChem CID 55799785) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(4-methylphenoxy)butyl]acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(4-methylphenoxy)butyl]acetamide |
|---|---|
| PubChem CID | 55799785 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(4-methylphenoxy)butyl]acetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)NCCCCOc3ccc(C)cc3)cs2)cc1OC |
| InChI | InChI=1S/C24H28N2O4S/c1-17-6-9-20(10-7-17)30-13-5-4-12-25-23(27)15-19-16-31-24(26-19)18-8-11-21(28-2)22(14-18)29-3/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,25,27) |
| InChIKey | WRTRIRKVEUMDLO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|