C19H24N2O3S — CID 4823194
N-cyclohexyl-2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 4823194) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is N-cyclohexyl-2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 4823194 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-cyclohexyl-2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)NC3CCCCC3)cs2)cc1OC |
| InChI | InChI=1S/C19H24N2O3S/c1-23-16-9-8-13(10-17(16)24-2)19-21-15(12-25-19)11-18(22)20-14-6-4-3-5-7-14/h8-10,12,14H,3-7,11H2,1-2H3,(H,20,22) |
| InChIKey | KYXSWCDGLRMOFO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |