C19H23ClN2OS — CID 39084543
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-cyclooctylacetamide (PubChem CID 39084543) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-cyclooctylacetamide.
| Compound Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-cyclooctylacetamide |
|---|---|
| PubChem CID | 39084543 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-N-cyclooctylacetamide |
| SMILES | O=C(Cc1csc(-c2ccc(Cl)cc2)n1)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H23ClN2OS/c20-15-10-8-14(9-11-15)19-22-17(13-24-19)12-18(23)21-16-6-4-2-1-3-5-7-16/h8-11,13,16H,1-7,12H2,(H,21,23) |
| InChIKey | LHFIRJWULXAIKU-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |