C20H26N2OS — CID 112816461
N-(4-ethylcyclohexyl)-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 112816461) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is N-(4-ethylcyclohexyl)-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-ethylcyclohexyl)-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 112816461 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-(4-ethylcyclohexyl)-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCC1CCC(NC(=O)Cc2csc(-c3ccc(C)cc3)n2)CC1 |
| InChI | InChI=1S/C20H26N2OS/c1-3-15-6-10-17(11-7-15)21-19(23)12-18-13-24-20(22-18)16-8-4-14(2)5-9-16/h4-5,8-9,13,15,17H,3,6-7,10-12H2,1-2H3,(H,21,23) |
| InChIKey | FDZSGVPYJRBIHH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |