C15H16N2OS — CID 17438306
N-cyclopropyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 17438306) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is N-cyclopropyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-cyclopropyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 17438306 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | N-cyclopropyl-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1cccc(-c2nc(CC(=O)NC3CC3)cs2)c1 |
| InChI | InChI=1S/C15H16N2OS/c1-10-3-2-4-11(7-10)15-17-13(9-19-15)8-14(18)16-12-5-6-12/h2-4,7,9,12H,5-6,8H2,1H3,(H,16,18) |
| InChIKey | WIHXQMNDDNUZEC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |