C16H17FN2OS — CID 26722000
N-cyclopentyl-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 26722000) has the molecular formula C16H17FN2OS and a molecular weight of 304.39 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-cyclopentyl-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 26722000 |
| Molecular Formula | C16H17FN2OS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-cyclopentyl-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2cccc(F)c2)n1)NC1CCCC1 |
| InChI | InChI=1S/C16H17FN2OS/c17-12-5-3-4-11(8-12)16-19-14(10-21-16)9-15(20)18-13-6-1-2-7-13/h3-5,8,10,13H,1-2,6-7,9H2,(H,18,20) |
| InChIKey | CZQSCFYTDFSHNJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |