C17H20FN3OS — CID 119474502
N-(4-aminocyclohexyl)-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 119474502) has the molecular formula C17H20FN3OS and a molecular weight of 333.43 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(4-aminocyclohexyl)-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119474502 |
| Molecular Formula | C17H20FN3OS |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | NC1CCC(NC(=O)Cc2csc(-c3cccc(F)c3)n2)CC1 |
| InChI | InChI=1S/C17H20FN3OS/c18-12-3-1-2-11(8-12)17-21-15(10-23-17)9-16(22)20-14-6-4-13(19)5-7-14/h1-3,8,10,13-14H,4-7,9,19H2,(H,20,22) |
| InChIKey | HUQCETTUHHFYAC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |