C23H31N3O3S — CID 56569123
2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide (PubChem CID 56569123) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 56569123 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)-1,3-thiazol-4-yl]-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]acetamide |
| SMILES | COc1ccc(-c2nc(CC(=O)NC3CCN(CC=C(C)C)CC3)cs2)cc1OC |
| InChI | InChI=1S/C23H31N3O3S/c1-16(2)7-10-26-11-8-18(9-12-26)24-22(27)14-19-15-30-23(25-19)17-5-6-20(28-3)21(13-17)29-4/h5-7,13,15,18H,8-12,14H2,1-4H3,(H,24,27) |
| InChIKey | OVTCZXPEFJKBPS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|