C22H24N2O3S — CID 55662555
N-[[4-(2-methoxyethoxy)phenyl]methyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55662555) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[[4-(2-methoxyethoxy)phenyl]methyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[[4-(2-methoxyethoxy)phenyl]methyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55662555 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[[4-(2-methoxyethoxy)phenyl]methyl]-2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | COCCOc1ccc(CNC(=O)Cc2csc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C22H24N2O3S/c1-16-3-7-18(8-4-16)22-24-19(15-28-22)13-21(25)23-14-17-5-9-20(10-6-17)27-12-11-26-2/h3-10,15H,11-14H2,1-2H3,(H,23,25) |
| InChIKey | UATUNPMMERLCEZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|