C22H24N2O4S — CID 55658227
2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(2-methoxyethoxy)phenyl]acetamide (PubChem CID 55658227) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(2-methoxyethoxy)phenyl]acetamide.
| Compound Name | 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(2-methoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 55658227 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]-N-[4-(2-methoxyethoxy)phenyl]acetamide |
| SMILES | CCOc1ccc(-c2nc(CC(=O)Nc3ccc(OCCOC)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-3-27-19-8-4-16(5-9-19)22-24-18(15-29-22)14-21(25)23-17-6-10-20(11-7-17)28-13-12-26-2/h4-11,15H,3,12-14H2,1-2H3,(H,23,25) |
| InChIKey | XOQZJOCHNATYNU-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|