C24H29N3O3S — CID 86898181
N-[4-[3-(dimethylamino)propoxy]phenyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 86898181) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propoxy]phenyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 86898181 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1ccc(-c2nc(CC(=O)Nc3ccc(OCCCN(C)C)cc3)cs2)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-29-21-10-6-18(7-11-21)24-26-20(17-31-24)16-23(28)25-19-8-12-22(13-9-19)30-15-5-14-27(2)3/h6-13,17H,4-5,14-16H2,1-3H3,(H,25,28) |
| InChIKey | CMUGFPAHHGUQOE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|