C19H16Cl2N2O2S — CID 46585773
N-(2,5-dichlorophenyl)-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 46585773) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 46585773 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[2-(4-ethoxyphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | CCOc1ccc(-c2nc(CC(=O)Nc3cc(Cl)ccc3Cl)cs2)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c1-2-25-15-6-3-12(4-7-15)19-22-14(11-26-19)10-18(24)23-17-9-13(20)5-8-16(17)21/h3-9,11H,2,10H2,1H3,(H,23,24) |
| InChIKey | UTKLWOFFNQKURZ-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |