C14H15NO4S — CID 20985054
2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 20985054) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 20985054 |
| Molecular Formula | C14H15NO4S |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCOc1cc(-c2nc(CC(=O)O)cs2)ccc1OC |
| InChI | InChI=1S/C14H15NO4S/c1-3-19-12-6-9(4-5-11(12)18-2)14-15-10(8-20-14)7-13(16)17/h4-6,8H,3,7H2,1-2H3,(H,16,17) |
| InChIKey | VLXZRXZTFOEEDK-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |