2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid

C14H15NO4S — CID 20985054

IUPAC2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid
SMILESCCOc1cc(-c2nc(CC(=O)O)cs2)ccc1OC
InChIInChI=1S/C14H15NO4S/c1-3-19-12-6-9(4-5-11(12)18-2)14-15-10(8-20-14)7-13(16)17/h4-6,8H,3,7H2,1-2H3,(H,16,17)
InChIKeyVLXZRXZTFOEEDK-UHFFFAOYSA-N
MW293.34 g/mol
LogP2.84
Rot. Bonds6

About 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid

2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 20985054) has the molecular formula C14H15NO4S and a molecular weight of 293.34 g/mol. Its IUPAC name is 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid
PubChem CID20985054
Molecular FormulaC14H15NO4S
Molecular Weight293.34 g/mol
Exact Mass293.07
IUPAC Name2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid
SMILESCCOc1cc(-c2nc(CC(=O)O)cs2)ccc1OC
InChIInChI=1S/C14H15NO4S/c1-3-19-12-6-9(4-5-11(12)18-2)14-15-10(8-20-14)7-13(16)17/h4-6,8H,3,7H2,1-2H3,(H,16,17)
InChIKeyVLXZRXZTFOEEDK-UHFFFAOYSA-N
XLogP2.84
TPSA68.65 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500293.34
LogP ≤ 52.84
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (CID 20985054) is 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid is CCOc1cc(-c2nc(CC(=O)O)cs2)ccc1OC.
What is the InChIKey of 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is VLXZRXZTFOEEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO4S/c1-3-19-12-6-9(4-5-11(12)18-2)14-15-10(8-20-14)7-13(16)17/h4-6,8H,3,7H2,1-2H3,(H,16,17).
What are the key properties of 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 293.34 g/mol, XLogP of 2.84, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3-ethoxy-4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 20985054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).