C14H15NO5S — CID 43322559
2-[2-(2,3,4-trimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43322559) has the molecular formula C14H15NO5S and a molecular weight of 309.34 g/mol. Its IUPAC name is 2-[2-(2,3,4-trimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(2,3,4-trimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43322559 |
| Molecular Formula | C14H15NO5S |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-[2-(2,3,4-trimethoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(-c2nc(CC(=O)O)cs2)c(OC)c1OC |
| InChI | InChI=1S/C14H15NO5S/c1-18-10-5-4-9(12(19-2)13(10)20-3)14-15-8(7-21-14)6-11(16)17/h4-5,7H,6H2,1-3H3,(H,16,17) |
| InChIKey | OTCJGGZJGGMTKO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |