C11H11ClN2O2S — CID 82548145
2-[2-(2-aminophenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride (PubChem CID 82548145) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-[2-(2-aminophenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride.
| Compound Name | 2-[2-(2-aminophenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 82548145 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-[2-(2-aminophenyl)-1,3-thiazol-4-yl]acetic acid;hydrochloride |
| SMILES | Cl.Nc1ccccc1-c1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C11H10N2O2S.ClH/c12-9-4-2-1-3-8(9)11-13-7(6-16-11)5-10(14)15;/h1-4,6H,5,12H2,(H,14,15);1H |
| InChIKey | YIVHHBNNJIXBGA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|