About 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid
2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid (PubChem CID 20988385) has the molecular formula C16H20N2O3S
and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 20988385 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid |
| SMILES | CN(C)CCCOc1ccccc1-c1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C16H20N2O3S/c1-18(2)8-5-9-21-14-7-4-3-6-13(14)16-17-12(11-22-16)10-15(19)20/h3-4,6-7,11H,5,8-10H2,1-2H3,(H,19,20) |
| InChIKey | OKGFVPTZLIKJPM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid (CID 20988385) is 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid is CN(C)CCCOc1ccccc1-c1nc(CC(=O)O)cs1.
What is the InChIKey of 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid?
The InChIKey is OKGFVPTZLIKJPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3S/c1-18(2)8-5-9-21-14-7-4-3-6-13(14)16-17-12(11-22-16)10-15(19)20/h3-4,6-7,11H,5,8-10H2,1-2H3,(H,19,20).
What are the key properties of 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid?
2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid has a molecular weight of 320.41 g/mol, XLogP of 2.77, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[3-(dimethylamino)propoxy]phenyl]-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 20988385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).