C17H22N2O3S — CID 42232157
2-[2-[2-[2-(diethylazaniumyl)ethoxy]phenyl]-1,3-thiazol-4-yl]acetate (PubChem CID 42232157) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[2-[2-[2-(diethylazaniumyl)ethoxy]phenyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-[2-(diethylazaniumyl)ethoxy]phenyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 42232157 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 2-[2-[2-[2-(diethylazaniumyl)ethoxy]phenyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CC[NH+](CC)CCOc1ccccc1-c1nc(CC(=O)[O-])cs1 |
| InChI | InChI=1S/C17H22N2O3S/c1-3-19(4-2)9-10-22-15-8-6-5-7-14(15)17-18-13(12-23-17)11-16(20)21/h5-8,12H,3-4,9-11H2,1-2H3,(H,20,21) |
| InChIKey | OUEXYKYLVLDLAL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |