C15H16NO4S- — CID 7745513
2-[2-[2-(2-ethoxyphenoxy)ethyl]-1,3-thiazol-4-yl]acetate (PubChem CID 7745513) has the molecular formula C15H16NO4S- and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-[2-[2-(2-ethoxyphenoxy)ethyl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[2-(2-ethoxyphenoxy)ethyl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7745513 |
| Molecular Formula | C15H16NO4S- |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[2-[2-(2-ethoxyphenoxy)ethyl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOc1ccccc1OCCc1nc(CC(=O)[O-])cs1 |
| InChI | InChI=1S/C15H17NO4S/c1-2-19-12-5-3-4-6-13(12)20-8-7-14-16-11(10-21-14)9-15(17)18/h3-6,10H,2,7-9H2,1H3,(H,17,18)/p-1 |
| InChIKey | VDNAOKZGRIHTFG-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 71.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |