C16H17N2O4S- — CID 9158227
2-[2-[(2R)-1-(2-ethoxyanilino)-1-oxopropan-2-yl]-1,3-thiazol-4-yl]acetate (PubChem CID 9158227) has the molecular formula C16H17N2O4S- and a molecular weight of 333.39 g/mol. Its IUPAC name is 2-[2-[(2R)-1-(2-ethoxyanilino)-1-oxopropan-2-yl]-1,3-thiazol-4-yl]acetate.
| Compound Name | 2-[2-[(2R)-1-(2-ethoxyanilino)-1-oxopropan-2-yl]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9158227 |
| Molecular Formula | C16H17N2O4S- |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 2-[2-[(2R)-1-(2-ethoxyanilino)-1-oxopropan-2-yl]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOc1ccccc1NC(=O)[C@@H](C)c1nc(CC(=O)[O-])cs1 |
| InChI | InChI=1S/C16H18N2O4S/c1-3-22-13-7-5-4-6-12(13)18-15(21)10(2)16-17-11(9-23-16)8-14(19)20/h4-7,9-10H,3,8H2,1-2H3,(H,18,21)(H,19,20)/p-1/t10-/m1/s1 |
| InChIKey | UDDHWUKCCCMSCF-SNVBAGLBSA-M |
| XLogP | 1.58 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |