C19H18N2O3S — CID 9155947
2-[2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 9155947) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is 2-[2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 9155947 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 2-[2-[2-(2-phenylphenoxy)ethylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCCOc2ccccc2-c2ccccc2)n1 |
| InChI | InChI=1S/C19H18N2O3S/c22-18(23)12-15-13-25-19(21-15)20-10-11-24-17-9-5-4-8-16(17)14-6-2-1-3-7-14/h1-9,13H,10-12H2,(H,20,21)(H,22,23) |
| InChIKey | XISSVYWGRKEIIB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|