C12H11BrN2O2S — CID 80575894
2-[2-[(2-bromophenyl)methylamino]-1,3-thiazol-4-yl]acetic acid (PubChem CID 80575894) has the molecular formula C12H11BrN2O2S and a molecular weight of 327.20 g/mol. Its IUPAC name is 2-[2-[(2-bromophenyl)methylamino]-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-[(2-bromophenyl)methylamino]-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 80575894 |
| Molecular Formula | C12H11BrN2O2S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-[2-[(2-bromophenyl)methylamino]-1,3-thiazol-4-yl]acetic acid |
| SMILES | O=C(O)Cc1csc(NCc2ccccc2Br)n1 |
| InChI | InChI=1S/C12H11BrN2O2S/c13-10-4-2-1-3-8(10)6-14-12-15-9(7-18-12)5-11(16)17/h1-4,7H,5-6H2,(H,14,15)(H,16,17) |
| InChIKey | KIEBIGXLDHMRQF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |