C6H7ClN2O3S — CID 87949636
2-(2-formamido-1,3-thiazol-4-yl)acetic acid;hydrochloride (PubChem CID 87949636) has the molecular formula C6H7ClN2O3S and a molecular weight of 222.65 g/mol. Its IUPAC name is 2-(2-formamido-1,3-thiazol-4-yl)acetic acid;hydrochloride.
| Compound Name | 2-(2-formamido-1,3-thiazol-4-yl)acetic acid;hydrochloride |
|---|---|
| PubChem CID | 87949636 |
| Molecular Formula | C6H7ClN2O3S |
| Molecular Weight | 222.65 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2-(2-formamido-1,3-thiazol-4-yl)acetic acid;hydrochloride |
| SMILES | Cl.O=CNc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C6H6N2O3S.ClH/c9-3-7-6-8-4(2-12-6)1-5(10)11;/h2-3H,1H2,(H,10,11)(H,7,8,9);1H |
| InChIKey | QHAMBKXNYRMENC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.65 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|