C6H9N3O4S2 — CID 114805146
2-[2-(methylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 114805146) has the molecular formula C6H9N3O4S2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-[2-(methylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(methylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 114805146 |
| Molecular Formula | C6H9N3O4S2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 2-[2-(methylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CNS(=O)(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C6H9N3O4S2/c1-7-15(12,13)9-6-8-4(3-14-6)2-5(10)11/h3,7H,2H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | HOAHNZOCJQRNHI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |