C11H19N3O4S2 — CID 43361116
2-[2-(dipropylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid (PubChem CID 43361116) has the molecular formula C11H19N3O4S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[2-(dipropylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid.
| Compound Name | 2-[2-(dipropylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 43361116 |
| Molecular Formula | C11H19N3O4S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[2-(dipropylsulfamoylamino)-1,3-thiazol-4-yl]acetic acid |
| SMILES | CCCN(CCC)S(=O)(=O)Nc1nc(CC(=O)O)cs1 |
| InChI | InChI=1S/C11H19N3O4S2/c1-3-5-14(6-4-2)20(17,18)13-11-12-9(8-19-11)7-10(15)16/h8H,3-7H2,1-2H3,(H,12,13)(H,15,16) |
| InChIKey | VXRFJEQXSLNMPF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |