C10H17N3O4S2 — CID 43624505
methyl 2-[2-(diethylsulfamoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 43624505) has the molecular formula C10H17N3O4S2 and a molecular weight of 307.40 g/mol. Its IUPAC name is methyl 2-[2-(diethylsulfamoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(diethylsulfamoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 43624505 |
| Molecular Formula | C10H17N3O4S2 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | methyl 2-[2-(diethylsulfamoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCN(CC)S(=O)(=O)Nc1nc(CC(=O)OC)cs1 |
| InChI | InChI=1S/C10H17N3O4S2/c1-4-13(5-2)19(15,16)12-10-11-8(7-18-10)6-9(14)17-3/h7H,4-6H2,1-3H3,(H,11,12) |
| InChIKey | UZLUHOYHORMJGH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |