C7H9N2NaO5S2 — CID 174221224
sodium N-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]sulfamate (PubChem CID 174221224) has the molecular formula C7H9N2NaO5S2 and a molecular weight of 288.28 g/mol. Its IUPAC name is sodium N-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]sulfamate.
| Compound Name | sodium N-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]sulfamate |
|---|---|
| PubChem CID | 174221224 |
| Molecular Formula | C7H9N2NaO5S2 |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | sodium N-[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]sulfamate |
| SMILES | CCOC(=O)Cc1csc(NS(=O)(=O)[O-])n1.[Na+] |
| InChI | InChI=1S/C7H10N2O5S2.Na/c1-2-14-6(10)3-5-4-15-7(8-5)9-16(11,12)13;/h4H,2-3H2,1H3,(H,8,9)(H,11,12,13);/q;+1/p-1 |
| InChIKey | BOWDCDWSYXNIQN-UHFFFAOYSA-M |
| XLogP | -2.88 |
| TPSA | 108.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|