C14H13N3O4S2 — CID 10269387
ethyl 2-[2-[(4-cyanophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 10269387) has the molecular formula C14H13N3O4S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is ethyl 2-[2-[(4-cyanophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(4-cyanophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 10269387 |
| Molecular Formula | C14H13N3O4S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | ethyl 2-[2-[(4-cyanophenyl)sulfonylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NS(=O)(=O)c2ccc(C#N)cc2)n1 |
| InChI | InChI=1S/C14H13N3O4S2/c1-2-21-13(18)7-11-9-22-14(16-11)17-23(19,20)12-5-3-10(8-15)4-6-12/h3-6,9H,2,7H2,1H3,(H,16,17) |
| InChIKey | MSBRGTIONVCFPM-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |