C16H15N3O4S2 — CID 10199594
ethyl 2-[2-(quinolin-8-ylsulfonylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 10199594) has the molecular formula C16H15N3O4S2 and a molecular weight of 377.45 g/mol. Its IUPAC name is ethyl 2-[2-(quinolin-8-ylsulfonylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(quinolin-8-ylsulfonylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 10199594 |
| Molecular Formula | C16H15N3O4S2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | ethyl 2-[2-(quinolin-8-ylsulfonylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NS(=O)(=O)c2cccc3cccnc23)n1 |
| InChI | InChI=1S/C16H15N3O4S2/c1-2-23-14(20)9-12-10-24-16(18-12)19-25(21,22)13-7-3-5-11-6-4-8-17-15(11)13/h3-8,10H,2,9H2,1H3,(H,18,19) |
| InChIKey | JVAFXOOYGZUHAM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |