C14H16N2O2S — CID 1132760
ethyl 2-[2-(benzylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 1132760) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is ethyl 2-[2-(benzylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(benzylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 1132760 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | ethyl 2-[2-(benzylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C14H16N2O2S/c1-2-18-13(17)8-12-10-19-14(16-12)15-9-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H,15,16) |
| InChIKey | WDGWOYRDNVIXFN-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |