C17H20N2O3S2 — CID 23886497
ethyl 2-[2-(2-benzylsulfanylpropanoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 23886497) has the molecular formula C17H20N2O3S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is ethyl 2-[2-(2-benzylsulfanylpropanoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2-benzylsulfanylpropanoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 23886497 |
| Molecular Formula | C17H20N2O3S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | ethyl 2-[2-(2-benzylsulfanylpropanoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(C)SCc2ccccc2)n1 |
| InChI | InChI=1S/C17H20N2O3S2/c1-3-22-15(20)9-14-11-24-17(18-14)19-16(21)12(2)23-10-13-7-5-4-6-8-13/h4-8,11-12H,3,9-10H2,1-2H3,(H,18,19,21) |
| InChIKey | LPEWNRIUXOJYDJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |