C16H18N2O4S — CID 3145095
ethyl 2-[2-(2-phenoxypropanoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 3145095) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is ethyl 2-[2-(2-phenoxypropanoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(2-phenoxypropanoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 3145095 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 2-[2-(2-phenoxypropanoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C(C)Oc2ccccc2)n1 |
| InChI | InChI=1S/C16H18N2O4S/c1-3-21-14(19)9-12-10-23-16(17-12)18-15(20)11(2)22-13-7-5-4-6-8-13/h4-8,10-11H,3,9H2,1-2H3,(H,17,18,20) |
| InChIKey | DETMSEXNDGUNJD-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |