C9H12N2O3S — CID 3477732
ethyl 2-(2-acetamido-1,3-thiazol-4-yl)acetate (PubChem CID 3477732) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is ethyl 2-(2-acetamido-1,3-thiazol-4-yl)acetate.
| Compound Name | ethyl 2-(2-acetamido-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 3477732 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | ethyl 2-(2-acetamido-1,3-thiazol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1csc(NC(C)=O)n1 |
| InChI | InChI=1S/C9H12N2O3S/c1-3-14-8(13)4-7-5-15-9(11-7)10-6(2)12/h5H,3-4H2,1-2H3,(H,10,11,12) |
| InChIKey | INGKHJJPHOQNBJ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |