C10H15N3O3S — CID 110460282
ethyl 2-[2-(3-aminopropanoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 110460282) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is ethyl 2-[2-(3-aminopropanoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(3-aminopropanoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 110460282 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | ethyl 2-[2-(3-aminopropanoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CCN)n1 |
| InChI | InChI=1S/C10H15N3O3S/c1-2-16-9(15)5-7-6-17-10(12-7)13-8(14)3-4-11/h6H,2-5,11H2,1H3,(H,12,13,14) |
| InChIKey | NWTVGHPTNHQJNF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |